C24H26N2O3 — CID 146285964
2-[[1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperidin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 146285964) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[[1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperidin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperidin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146285964 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[[1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]piperidin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | CC(c1ccc2c(c1)OCC2)N1CCCC(CN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C24H26N2O3/c1-16(19-9-8-18-10-12-29-22(18)13-19)25-11-4-5-17(14-25)15-26-23(27)20-6-2-3-7-21(20)24(26)28/h2-3,6-9,13,16-17H,4-5,10-12,14-15H2,1H3 |
| InChIKey | LWOHTDULCVJOMA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|