C48H48N3O3P3 — CID 146286722
1-[3,5-bis(3-diphenylphosphanylpropanoyl)-1,3,5-triazinan-1-yl]-3-diphenylphosphanylpropan-1-one (PubChem CID 146286722) has the molecular formula C48H48N3O3P3 and a molecular weight of 807.85 g/mol. Its IUPAC name is 1-[3,5-bis(3-diphenylphosphanylpropanoyl)-1,3,5-triazinan-1-yl]-3-diphenylphosphanylpropan-1-one.
| Compound Name | 1-[3,5-bis(3-diphenylphosphanylpropanoyl)-1,3,5-triazinan-1-yl]-3-diphenylphosphanylpropan-1-one |
|---|---|
| PubChem CID | 146286722 |
| Molecular Formula | C48H48N3O3P3 |
| Molecular Weight | 807.85 g/mol |
| Exact Mass | 807.29 |
| IUPAC Name | 1-[3,5-bis(3-diphenylphosphanylpropanoyl)-1,3,5-triazinan-1-yl]-3-diphenylphosphanylpropan-1-one |
| SMILES | O=C(CCP(c1ccccc1)c1ccccc1)N1CN(C(=O)CCP(c2ccccc2)c2ccccc2)CN(C(=O)CCP(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C48H48N3O3P3/c52-46(31-34-55(40-19-7-1-8-20-40)41-21-9-2-10-22-41)49-37-50(47(53)32-35-56(42-23-11-3-12-24-42)43-25-13-4-14-26-43)39-51(38-49)48(54)33-36-57(44-27-15-5-16-28-44)45-29-17-6-18-30-45/h1-30H,31-39H2 |
| InChIKey | MFLXQGOQFISVAY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.85 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|