C23H28F3NO2 — CID 146286937
tert-butyl 5-[(2Z,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-5-yl]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 146286937) has the molecular formula C23H28F3NO2 and a molecular weight of 407.48 g/mol. Its IUPAC name is tert-butyl 5-[(2Z,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-5-yl]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-[(2Z,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-5-yl]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 146286937 |
| Molecular Formula | C23H28F3NO2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | tert-butyl 5-[(2Z,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-5-yl]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C/C=C\C=C(C(=C/CC)/C(F)(F)F)\c1ccc2c(c1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C23H28F3NO2/c1-6-8-10-19(20(9-7-2)23(24,25)26)16-11-12-17-14-27(15-18(17)13-16)21(28)29-22(3,4)5/h6,8-13H,7,14-15H2,1-5H3/b8-6-,19-10-,20-9- |
| InChIKey | OIJNJDXZENKTDM-NVSNEALQSA-N |
| XLogP | 6.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|