About 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole
5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole (PubChem CID 146286942) has the molecular formula C15H12F4N2
and a molecular weight of 296.27 g/mol. Its IUPAC name is 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole |
| PubChem CID | 146286942 |
| Molecular Formula | C15H12F4N2 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole |
| SMILES | CN1Cc2ccc(-c3cncc(F)c3C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C15H12F4N2/c1-21-7-10-3-2-9(4-11(10)8-21)12-5-20-6-13(16)14(12)15(17,18)19/h2-6H,7-8H2,1H3 |
| InChIKey | BATQBSJUZZCXCJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole?
The IUPAC name of 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole (CID 146286942) is 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole.
What is the SMILES notation for 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole?
The canonical SMILES for 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole is CN1Cc2ccc(-c3cncc(F)c3C(F)(F)F)cc2C1.
What is the InChIKey of 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole?
The InChIKey is BATQBSJUZZCXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F4N2/c1-21-7-10-3-2-9(4-11(10)8-21)12-5-20-6-13(16)14(12)15(17,18)19/h2-6H,7-8H2,1H3.
What are the key properties of 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole?
5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole has a molecular weight of 296.27 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-fluoro-4-(trifluoromethyl)-3-pyridinyl]-2-methyl-1,3-dihydroisoindole is sourced from PubChem (CID 146286942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).