About 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide
4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide (PubChem CID 146287752) has the molecular formula C13H23N3O3S
and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide |
| PubChem CID | 146287752 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide |
| SMILES | CNC(=O)c1nc(C(C)=O)cn1COCCS(C)(C)C |
| InChI | InChI=1S/C13H23N3O3S/c1-10(17)11-8-16(12(15-11)13(18)14-2)9-19-6-7-20(3,4)5/h8H,6-7,9H2,1-5H3,(H,14,18) |
| InChIKey | IKEGKGJOVQPIDM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide?
The IUPAC name of 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide (CID 146287752) is 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide.
What is the SMILES notation for 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide?
The canonical SMILES for 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide is CNC(=O)c1nc(C(C)=O)cn1COCCS(C)(C)C.
What is the InChIKey of 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide?
The InChIKey is IKEGKGJOVQPIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3S/c1-10(17)11-8-16(12(15-11)13(18)14-2)9-19-6-7-20(3,4)5/h8H,6-7,9H2,1-5H3,(H,14,18).
What are the key properties of 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide?
4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide has a molecular weight of 301.41 g/mol, XLogP of 1.11, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-methyl-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazole-2-carboxamide is sourced from PubChem (CID 146287752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).