About 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine
5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine (PubChem CID 146287766) has the molecular formula C18H27N5
and a molecular weight of 313.45 g/mol. Its IUPAC name is 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine |
| PubChem CID | 146287766 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine |
| SMILES | Cc1cc(C[C@H]2CCCN(Cc3cc(N)nn3C)C2)cc(C)n1 |
| InChI | InChI=1S/C18H27N5/c1-13-7-16(8-14(2)20-13)9-15-5-4-6-23(11-15)12-17-10-18(19)21-22(17)3/h7-8,10,15H,4-6,9,11-12H2,1-3H3,(H2,19,21)/t15-/m1/s1 |
| InChIKey | BPFQZNXJTXWBQX-OAHLLOKOSA-N |
| XLogP | 2.47 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine?
The IUPAC name of 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine (CID 146287766) is 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine.
What is the SMILES notation for 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine?
The canonical SMILES for 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine is Cc1cc(C[C@H]2CCCN(Cc3cc(N)nn3C)C2)cc(C)n1.
What is the InChIKey of 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine?
The InChIKey is BPFQZNXJTXWBQX-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H27N5/c1-13-7-16(8-14(2)20-13)9-15-5-4-6-23(11-15)12-17-10-18(19)21-22(17)3/h7-8,10,15H,4-6,9,11-12H2,1-3H3,(H2,19,21)/t15-/m1/s1.
What are the key properties of 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine?
5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine has a molecular weight of 313.45 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3R)-3-[(2,6-dimethyl-4-pyridinyl)methyl]piperidin-1-yl]methyl]-1-methylpyrazol-3-amine is sourced from PubChem (CID 146287766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).