C24H28O5 — CID 14628822
ethyl 2-[(2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 14628822) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 14628822 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ethyl 2-[(2R,3S,6S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C=C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C24H28O5/c1-2-27-24(25)15-21-13-14-22(28-17-20-11-7-4-8-12-20)23(29-21)18-26-16-19-9-5-3-6-10-19/h3-14,21-23H,2,15-18H2,1H3/t21-,22+,23-/m1/s1 |
| InChIKey | UYAWSMMZPIHXDH-XPWALMASSA-N |
| XLogP | 4.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|