About 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine
4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine (PubChem CID 146288288) has the molecular formula C12H13BrF2N2
and a molecular weight of 303.15 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine |
| PubChem CID | 146288288 |
| Molecular Formula | C12H13BrF2N2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine |
| SMILES | CC(C)C(F)(F)Cn1ccc2c(Br)nccc21 |
| InChI | InChI=1S/C12H13BrF2N2/c1-8(2)12(14,15)7-17-6-4-9-10(17)3-5-16-11(9)13/h3-6,8H,7H2,1-2H3 |
| InChIKey | JMVYOUVZESXUDI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine?
The IUPAC name of 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine (CID 146288288) is 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine?
The canonical SMILES for 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine is CC(C)C(F)(F)Cn1ccc2c(Br)nccc21.
What is the InChIKey of 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine?
The InChIKey is JMVYOUVZESXUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF2N2/c1-8(2)12(14,15)7-17-6-4-9-10(17)3-5-16-11(9)13/h3-6,8H,7H2,1-2H3.
What are the key properties of 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine?
4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine has a molecular weight of 303.15 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,2-difluoro-3-methylbutyl)pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 146288288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).