About 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole
3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole (PubChem CID 146288408) has the molecular formula C12H10ClN3O
and a molecular weight of 247.69 g/mol. Its IUPAC name is 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole |
| PubChem CID | 146288408 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(Cn2ccc3c(Cl)nccc32)no1 |
| InChI | InChI=1S/C12H10ClN3O/c1-8-6-9(15-17-8)7-16-5-3-10-11(16)2-4-14-12(10)13/h2-6H,7H2,1H3 |
| InChIKey | RFXHOADQDACKNN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole?
The IUPAC name of 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole (CID 146288408) is 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole.
What is the SMILES notation for 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole?
The canonical SMILES for 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole is Cc1cc(Cn2ccc3c(Cl)nccc32)no1.
What is the InChIKey of 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole?
The InChIKey is RFXHOADQDACKNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O/c1-8-6-9(15-17-8)7-16-5-3-10-11(16)2-4-14-12(10)13/h2-6H,7H2,1H3.
What are the key properties of 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole?
3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole has a molecular weight of 247.69 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloropyrrolo[3,2-c]pyridin-1-yl)methyl]-5-methyl-1,2-oxazole is sourced from PubChem (CID 146288408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).