C20H19BrF2N2S3 — CID 146288486
4-bromo-7-[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-5,6-difluoro-2,1,3-benzothiadiazole (PubChem CID 146288486) has the molecular formula C20H19BrF2N2S3 and a molecular weight of 501.49 g/mol. Its IUPAC name is 4-bromo-7-[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-5,6-difluoro-2,1,3-benzothiadiazole.
| Compound Name | 4-bromo-7-[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 146288486 |
| Molecular Formula | C20H19BrF2N2S3 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 499.99 |
| IUPAC Name | 4-bromo-7-[2-(2-ethylhexyl)thieno[3,2-b]thiophen-5-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
| SMILES | CCCCC(CC)Cc1cc2sc(-c3c(F)c(F)c(Br)c4nsnc34)cc2s1 |
| InChI | InChI=1S/C20H19BrF2N2S3/c1-3-5-6-10(4-2)7-11-8-12-13(26-11)9-14(27-12)15-17(22)18(23)16(21)20-19(15)24-28-25-20/h8-10H,3-7H2,1-2H3 |
| InChIKey | RECDAMVJSZBFDT-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|