C9H16N2O — CID 146288774
(2Z,4E)-6-methoxy-5-N-methylhepta-2,4,6-triene-2,5-diamine (PubChem CID 146288774) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (2Z,4E)-6-methoxy-5-N-methylhepta-2,4,6-triene-2,5-diamine.
| Compound Name | (2Z,4E)-6-methoxy-5-N-methylhepta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 146288774 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (2Z,4E)-6-methoxy-5-N-methylhepta-2,4,6-triene-2,5-diamine |
| SMILES | C=C(OC)/C(=C\C=C(\C)N)NC |
| InChI | InChI=1S/C9H16N2O/c1-7(10)5-6-9(11-3)8(2)12-4/h5-6,11H,2,10H2,1,3-4H3/b7-5-,9-6+ |
| InChIKey | XFUGWWXJKZMMRP-XCZNYUDNSA-N |
| XLogP | 1.11 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|