C9H16N2O — CID 146288848
(3Z,5E)-6-amino-3-methyl-5-(methylamino)hepta-1,3,5-trien-2-ol (PubChem CID 146288848) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (3Z,5E)-6-amino-3-methyl-5-(methylamino)hepta-1,3,5-trien-2-ol.
| Compound Name | (3Z,5E)-6-amino-3-methyl-5-(methylamino)hepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 146288848 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (3Z,5E)-6-amino-3-methyl-5-(methylamino)hepta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C(C)=C\C(NC)=C(\C)N |
| InChI | InChI=1S/C9H16N2O/c1-6(8(3)12)5-9(11-4)7(2)10/h5,11-12H,3,10H2,1-2,4H3/b6-5-,9-7+ |
| InChIKey | HWOFLRFWVMDFET-BZWSEGBZSA-N |
| XLogP | 1.41 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|