C37H48FN11O — CID 146289664
(2R)-2-[[6-(benzylamino)-9-[1-[5-[[(2-fluoro-9-methylpurin-6-yl)amino]methyl]-2-adamantyl]propan-2-yl]purin-2-yl]-methylamino]butan-1-ol (PubChem CID 146289664) has the molecular formula C37H48FN11O and a molecular weight of 681.87 g/mol. Its IUPAC name is (2R)-2-[[6-(benzylamino)-9-[1-[5-[[(2-fluoro-9-methylpurin-6-yl)amino]methyl]-2-adamantyl]propan-2-yl]purin-2-yl]-methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[6-(benzylamino)-9-[1-[5-[[(2-fluoro-9-methylpurin-6-yl)amino]methyl]-2-adamantyl]propan-2-yl]purin-2-yl]-methylamino]butan-1-ol |
|---|---|
| PubChem CID | 146289664 |
| Molecular Formula | C37H48FN11O |
| Molecular Weight | 681.87 g/mol |
| Exact Mass | 681.40 |
| IUPAC Name | (2R)-2-[[6-(benzylamino)-9-[1-[5-[[(2-fluoro-9-methylpurin-6-yl)amino]methyl]-2-adamantyl]propan-2-yl]purin-2-yl]-methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)N(C)c1nc(NCc2ccccc2)c2ncn(C(C)CC3C4CC5CC3CC(CNc3nc(F)nc6c3ncn6C)(C5)C4)c2n1 |
| InChI | InChI=1S/C37H48FN11O/c1-5-27(18-50)48(4)36-44-31(39-17-23-9-7-6-8-10-23)30-34(46-36)49(21-42-30)22(2)11-28-25-12-24-13-26(28)16-37(14-24,15-25)19-40-32-29-33(45-35(38)43-32)47(3)20-41-29/h6-10,20-22,24-28,50H,5,11-19H2,1-4H3,(H,39,44,46)(H,40,43,45)/t22?,24?,25?,26?,27-,28?,37?/m1/s1 |
| InChIKey | DVOIBGMPIZWPSS-YXRKLSRJSA-N |
| XLogP | 5.97 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |