C19H16F2N4O5 — CID 146289838
3-[6-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 146289838) has the molecular formula C19H16F2N4O5 and a molecular weight of 418.36 g/mol. Its IUPAC name is 3-[6-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[6-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146289838 |
| Molecular Formula | C19H16F2N4O5 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 3-[6-[(2,2-difluoro-1,3-benzodioxol-5-yl)oxy]pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1c1cc(Oc2ccc3c(c2)OC(F)(F)O3)ncn1 |
| InChI | InChI=1S/C19H16F2N4O5/c20-19(21)29-12-5-4-11(8-13(12)30-19)28-15-9-14(22-10-23-15)25-16(26)18(24-17(25)27)6-2-1-3-7-18/h4-5,8-10H,1-3,6-7H2,(H,24,27) |
| InChIKey | FPAGPZRPRSARGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|