C20H22N4O4 — CID 146289881
7-[6-(3-methoxy-4-methylphenoxy)pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 146289881) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 7-[6-(3-methoxy-4-methylphenoxy)pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 7-[6-(3-methoxy-4-methylphenoxy)pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146289881 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 7-[6-(3-methoxy-4-methylphenoxy)pyrimidin-4-yl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cc(Oc2cc(C3CCCC4(C3)NC(=O)NC4=O)ncn2)ccc1C |
| InChI | InChI=1S/C20H22N4O4/c1-12-5-6-14(8-16(12)27-2)28-17-9-15(21-11-22-17)13-4-3-7-20(10-13)18(25)23-19(26)24-20/h5-6,8-9,11,13H,3-4,7,10H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | AXJHTBCJWJXTOG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|