C26H19F6N7OS — CID 146290101
1-[5-ethylsulfinyl-1-methyl-4-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]imidazol-2-yl]-4-(4-fluorophenyl)pyrrole-3-carbonitrile (PubChem CID 146290101) has the molecular formula C26H19F6N7OS and a molecular weight of 591.54 g/mol. Its IUPAC name is 1-[5-ethylsulfinyl-1-methyl-4-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]imidazol-2-yl]-4-(4-fluorophenyl)pyrrole-3-carbonitrile.
| Compound Name | 1-[5-ethylsulfinyl-1-methyl-4-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]imidazol-2-yl]-4-(4-fluorophenyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 146290101 |
| Molecular Formula | C26H19F6N7OS |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 1-[5-ethylsulfinyl-1-methyl-4-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]imidazol-2-yl]-4-(4-fluorophenyl)pyrrole-3-carbonitrile |
| SMILES | CCS(=O)c1c(-c2nc3cc(C(F)(F)C(F)(F)F)cnc3n2C)nc(-n2cc(C#N)c(-c3ccc(F)cc3)c2)n1C |
| InChI | InChI=1S/C26H19F6N7OS/c1-4-41(40)23-20(22-35-19-9-16(11-34-21(19)37(22)2)25(28,29)26(30,31)32)36-24(38(23)3)39-12-15(10-33)18(13-39)14-5-7-17(27)8-6-14/h5-9,11-13H,4H2,1-3H3 |
| InChIKey | WJZKEDBBGPYKNU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|