C8H10FNS — CID 146290452
4-(1-fluorocyclopropyl)-2,5-dimethyl-1,3-thiazole (PubChem CID 146290452) has the molecular formula C8H10FNS and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-(1-fluorocyclopropyl)-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-(1-fluorocyclopropyl)-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 146290452 |
| Molecular Formula | C8H10FNS |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-(1-fluorocyclopropyl)-2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C2(F)CC2)c(C)s1 |
| InChI | InChI=1S/C8H10FNS/c1-5-7(8(9)3-4-8)10-6(2)11-5/h3-4H2,1-2H3 |
| InChIKey | CTCSTQCOQRVBLE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |