About 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole
3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole (PubChem CID 146290476) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole.
Molecular Properties
| Compound Name | 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole |
| PubChem CID | 146290476 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole |
| SMILES | C=C1C=C(CF)C(C)N1C |
| InChI | InChI=1S/C8H12FN/c1-6-4-8(5-9)7(2)10(6)3/h4,7H,1,5H2,2-3H3 |
| InChIKey | PPRDQVQGPNNQFL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole?
The IUPAC name of 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole (CID 146290476) is 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole.
What is the SMILES notation for 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole?
The canonical SMILES for 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole is C=C1C=C(CF)C(C)N1C.
What is the InChIKey of 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole?
The InChIKey is PPRDQVQGPNNQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-6-4-8(5-9)7(2)10(6)3/h4,7H,1,5H2,2-3H3.
What are the key properties of 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole?
3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole has a molecular weight of 141.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(fluoromethyl)-1,2-dimethyl-5-methylidene-2H-pyrrole is sourced from PubChem (CID 146290476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).