About (9-phenylcarbazol-4-yl) trifluoromethanesulfonate
(9-phenylcarbazol-4-yl) trifluoromethanesulfonate (PubChem CID 146291147) has the molecular formula C19H12F3NO3S
and a molecular weight of 391.37 g/mol. Its IUPAC name is (9-phenylcarbazol-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (9-phenylcarbazol-4-yl) trifluoromethanesulfonate |
| PubChem CID | 146291147 |
| Molecular Formula | C19H12F3NO3S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (9-phenylcarbazol-4-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc2c1c1ccccc1n2-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H12F3NO3S/c20-19(21,22)27(24,25)26-17-12-6-11-16-18(17)14-9-4-5-10-15(14)23(16)13-7-2-1-3-8-13/h1-12H |
| InChIKey | NFDOCDFALVXWKF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (9-phenylcarbazol-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-phenylcarbazol-4-yl) trifluoromethanesulfonate?
The IUPAC name of (9-phenylcarbazol-4-yl) trifluoromethanesulfonate (CID 146291147) is (9-phenylcarbazol-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (9-phenylcarbazol-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (9-phenylcarbazol-4-yl) trifluoromethanesulfonate is O=S(=O)(Oc1cccc2c1c1ccccc1n2-c1ccccc1)C(F)(F)F.
What is the InChIKey of (9-phenylcarbazol-4-yl) trifluoromethanesulfonate?
The InChIKey is NFDOCDFALVXWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3NO3S/c20-19(21,22)27(24,25)26-17-12-6-11-16-18(17)14-9-4-5-10-15(14)23(16)13-7-2-1-3-8-13/h1-12H.
What are the key properties of (9-phenylcarbazol-4-yl) trifluoromethanesulfonate?
(9-phenylcarbazol-4-yl) trifluoromethanesulfonate has a molecular weight of 391.37 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-phenylcarbazol-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 146291147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).