C20H28O7S — CID 146291502
2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]acetaldehyde (PubChem CID 146291502) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 146291502 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-4-methoxyoxolan-2-yl]acetaldehyde |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1CC1COC(C)(C)O1 |
| InChI | InChI=1S/C20H28O7S/c1-20(2)25-12-14(27-20)11-18-19(24-3)16(17(26-18)9-10-21)13-28(22,23)15-7-5-4-6-8-15/h4-8,10,14,16-19H,9,11-13H2,1-3H3/t14?,16-,17-,18+,19+/m0/s1 |
| InChIKey | MEYGPVWNDAFEBJ-DNYQBBQESA-N |
| XLogP | 1.99 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|