C21H19FN2O2 — CID 146291808
ethyl (2Z)-2-fluoro-2-(1-naphthalen-2-yl-5,6-dihydro-4H-indazol-7-ylidene)acetate (PubChem CID 146291808) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is ethyl (2Z)-2-fluoro-2-(1-naphthalen-2-yl-5,6-dihydro-4H-indazol-7-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-fluoro-2-(1-naphthalen-2-yl-5,6-dihydro-4H-indazol-7-ylidene)acetate |
|---|---|
| PubChem CID | 146291808 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | ethyl (2Z)-2-fluoro-2-(1-naphthalen-2-yl-5,6-dihydro-4H-indazol-7-ylidene)acetate |
| SMILES | CCOC(=O)/C(F)=C1\CCCc2cnn(-c3ccc4ccccc4c3)c21 |
| InChI | InChI=1S/C21H19FN2O2/c1-2-26-21(25)19(22)18-9-5-8-16-13-23-24(20(16)18)17-11-10-14-6-3-4-7-15(14)12-17/h3-4,6-7,10-13H,2,5,8-9H2,1H3/b19-18- |
| InChIKey | KTLXGCVWTGJXOG-HNENSFHCSA-N |
| XLogP | 4.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|