C5H12OS9 — CID 146291911
2-methyl-4-sulfanyloxybutane-1,1,1,2,3,3,4,4-octathiol (PubChem CID 146291911) has the molecular formula C5H12OS9 and a molecular weight of 376.75 g/mol. Its IUPAC name is 2-methyl-4-sulfanyloxybutane-1,1,1,2,3,3,4,4-octathiol.
| Compound Name | 2-methyl-4-sulfanyloxybutane-1,1,1,2,3,3,4,4-octathiol |
|---|---|
| PubChem CID | 146291911 |
| Molecular Formula | C5H12OS9 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 375.84 |
| IUPAC Name | 2-methyl-4-sulfanyloxybutane-1,1,1,2,3,3,4,4-octathiol |
| SMILES | CC(S)(C(S)(S)S)C(S)(S)C(S)(S)OS |
| InChI | InChI=1S/C5H12OS9/c1-2(7,5(12,13)14)3(8,9)4(10,11)6-15/h7-15H,1H3 |
| InChIKey | BKSNCSHZUKFQQS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|