C27H38N4O4S — CID 146292047
1-(2-amino-2-ethyl-3-oxooctanoyl)-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 146292047) has the molecular formula C27H38N4O4S and a molecular weight of 514.69 g/mol. Its IUPAC name is 1-(2-amino-2-ethyl-3-oxooctanoyl)-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-2-ethyl-3-oxooctanoyl)-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146292047 |
| Molecular Formula | C27H38N4O4S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 1-(2-amino-2-ethyl-3-oxooctanoyl)-4-hydroxy-N-[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCC(=O)C(N)(CC)C(=O)N1CC(O)CC1C(=O)N[C@@H](C)c1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C27H38N4O4S/c1-5-7-8-9-23(33)27(28,6-2)26(35)31-15-21(32)14-22(31)25(34)30-17(3)19-10-12-20(13-11-19)24-18(4)29-16-36-24/h10-13,16-17,21-22,32H,5-9,14-15,28H2,1-4H3,(H,30,34)/t17-,21?,22?,27?/m0/s1 |
| InChIKey | MLLDHAOCGJXXPI-WMIHNSDKSA-N |
| XLogP | 3.51 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|