C31H52F2N4 — CID 146292260
(E)-2-N-[(3E,7Z)-7-[(Z)-2-aminoethenyl]-12,12-difluoro-3-methyl-6-prop-1-enyltrideca-1,3,7-trien-2-yl]-3-N-(3,3-dimethylpent-4-enyl)-1-N,3-N-dimethylprop-1-ene-1,2,3-triamine (PubChem CID 146292260) has the molecular formula C31H52F2N4 and a molecular weight of 518.78 g/mol. Its IUPAC name is (E)-2-N-[(3E,7Z)-7-[(Z)-2-aminoethenyl]-12,12-difluoro-3-methyl-6-prop-1-enyltrideca-1,3,7-trien-2-yl]-3-N-(3,3-dimethylpent-4-enyl)-1-N,3-N-dimethylprop-1-ene-1,2,3-triamine.
| Compound Name | (E)-2-N-[(3E,7Z)-7-[(Z)-2-aminoethenyl]-12,12-difluoro-3-methyl-6-prop-1-enyltrideca-1,3,7-trien-2-yl]-3-N-(3,3-dimethylpent-4-enyl)-1-N,3-N-dimethylprop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 146292260 |
| Molecular Formula | C31H52F2N4 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.42 |
| IUPAC Name | (E)-2-N-[(3E,7Z)-7-[(Z)-2-aminoethenyl]-12,12-difluoro-3-methyl-6-prop-1-enyltrideca-1,3,7-trien-2-yl]-3-N-(3,3-dimethylpent-4-enyl)-1-N,3-N-dimethylprop-1-ene-1,2,3-triamine |
| SMILES | C=CC(C)(C)CCN(C)C/C(=C\NC)NC(=C)/C(C)=C/CC(C=CC)C(/C=C\N)=C/CCCC(C)(F)F |
| InChI | InChI=1S/C31H52F2N4/c1-10-14-27(28(18-21-34)15-12-13-19-31(7,32)33)17-16-25(3)26(4)36-29(23-35-8)24-37(9)22-20-30(5,6)11-2/h10-11,14-16,18,21,23,27,35-36H,2,4,12-13,17,19-20,22,24,34H2,1,3,5-9H3/b14-10?,21-18-,25-16+,28-15+,29-23+ |
| InChIKey | SPPVDKSTLCPEKW-JNFWUCISSA-N |
| XLogP | 7.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|