C16H23NO — CID 146292296
4-ethenyl-3-methyl-2-[(2Z,4E)-7-methyl-6-methylideneocta-2,4-dien-4-yl]-2H-1,3-oxazole (PubChem CID 146292296) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-ethenyl-3-methyl-2-[(2Z,4E)-7-methyl-6-methylideneocta-2,4-dien-4-yl]-2H-1,3-oxazole.
| Compound Name | 4-ethenyl-3-methyl-2-[(2Z,4E)-7-methyl-6-methylideneocta-2,4-dien-4-yl]-2H-1,3-oxazole |
|---|---|
| PubChem CID | 146292296 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 4-ethenyl-3-methyl-2-[(2Z,4E)-7-methyl-6-methylideneocta-2,4-dien-4-yl]-2H-1,3-oxazole |
| SMILES | C=CC1=COC(C(/C=C\C)=C/C(=C)C(C)C)N1C |
| InChI | InChI=1S/C16H23NO/c1-7-9-14(10-13(5)12(3)4)16-17(6)15(8-2)11-18-16/h7-12,16H,2,5H2,1,3-4,6H3/b9-7-,14-10+ |
| InChIKey | KOMPKZQFOJFDLA-TUZZZSKRSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|