C33H56N4 — CID 146292299
(E)-2-N-[(3E,7E,8Z)-3,10-dimethyl-7-(2-methylpropylidene)-6-prop-1-enylundeca-1,3,8-trien-2-yl]-1-N,3-N-dimethyl-3-(3,3,4-trimethyl-2-methylidenepyrrolidin-1-yl)prop-1-ene-1,2,3-triamine (PubChem CID 146292299) has the molecular formula C33H56N4 and a molecular weight of 508.84 g/mol. Its IUPAC name is (E)-2-N-[(3E,7E,8Z)-3,10-dimethyl-7-(2-methylpropylidene)-6-prop-1-enylundeca-1,3,8-trien-2-yl]-1-N,3-N-dimethyl-3-(3,3,4-trimethyl-2-methylidenepyrrolidin-1-yl)prop-1-ene-1,2,3-triamine.
| Compound Name | (E)-2-N-[(3E,7E,8Z)-3,10-dimethyl-7-(2-methylpropylidene)-6-prop-1-enylundeca-1,3,8-trien-2-yl]-1-N,3-N-dimethyl-3-(3,3,4-trimethyl-2-methylidenepyrrolidin-1-yl)prop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 146292299 |
| Molecular Formula | C33H56N4 |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.45 |
| IUPAC Name | (E)-2-N-[(3E,7E,8Z)-3,10-dimethyl-7-(2-methylpropylidene)-6-prop-1-enylundeca-1,3,8-trien-2-yl]-1-N,3-N-dimethyl-3-(3,3,4-trimethyl-2-methylidenepyrrolidin-1-yl)prop-1-ene-1,2,3-triamine |
| SMILES | C=C(N/C(=C/NC)C(NC)N1CC(C)C(C)(C)C1=C)/C(C)=C/CC(C=CC)C(/C=C\C(C)C)=C/C(C)C |
| InChI | InChI=1S/C33H56N4/c1-14-15-29(30(20-24(4)5)18-16-23(2)3)19-17-25(6)27(8)36-31(21-34-12)32(35-13)37-22-26(7)33(10,11)28(37)9/h14-18,20-21,23-24,26,29,32,34-36H,8-9,19,22H2,1-7,10-13H3/b15-14?,18-16-,25-17+,30-20+,31-21+ |
| InChIKey | BQHDAORWHXGXMQ-UIEUXTGDSA-N |
| XLogP | 7.51 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|