C34H43FN2O3 — CID 146292368
N-[2-fluoro-4-[[(1S,7R,9S,10S)-14-hydroxy-9-pentacyclo[8.8.0.02,7.05,7.011,16]octadeca-11(16),12,14-trienyl]oxy]phenyl]-5-piperidin-1-ylpentanamide (PubChem CID 146292368) has the molecular formula C34H43FN2O3 and a molecular weight of 546.73 g/mol. Its IUPAC name is N-[2-fluoro-4-[[(1S,7R,9S,10S)-14-hydroxy-9-pentacyclo[8.8.0.02,7.05,7.011,16]octadeca-11(16),12,14-trienyl]oxy]phenyl]-5-piperidin-1-ylpentanamide.
| Compound Name | N-[2-fluoro-4-[[(1S,7R,9S,10S)-14-hydroxy-9-pentacyclo[8.8.0.02,7.05,7.011,16]octadeca-11(16),12,14-trienyl]oxy]phenyl]-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 146292368 |
| Molecular Formula | C34H43FN2O3 |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | N-[2-fluoro-4-[[(1S,7R,9S,10S)-14-hydroxy-9-pentacyclo[8.8.0.02,7.05,7.011,16]octadeca-11(16),12,14-trienyl]oxy]phenyl]-5-piperidin-1-ylpentanamide |
| SMILES | O=C(CCCCN1CCCCC1)Nc1ccc(O[C@H]2C[C@]34CC3CCC4[C@@H]3CCc4cc(O)ccc4[C@@H]23)cc1F |
| InChI | InChI=1S/C34H43FN2O3/c35-29-19-25(10-14-30(29)36-32(39)6-2-5-17-37-15-3-1-4-16-37)40-31-21-34-20-23(34)8-13-28(34)27-11-7-22-18-24(38)9-12-26(22)33(27)31/h9-10,12,14,18-19,23,27-28,31,33,38H,1-8,11,13,15-17,20-21H2,(H,36,39)/t23?,27-,28?,31-,33+,34+/m0/s1 |
| InChIKey | DONIMHDGWMCHRN-STHKHATQSA-N |
| XLogP | 7.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|