C35H32O3 — CID 146292728
5-[(E)-2-[7-[(E)-2-(3-ethoxy-4-methylphenyl)ethenyl]-9,9-dimethylfluoren-2-yl]ethenyl]-1,3-benzodioxole (PubChem CID 146292728) has the molecular formula C35H32O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 5-[(E)-2-[7-[(E)-2-(3-ethoxy-4-methylphenyl)ethenyl]-9,9-dimethylfluoren-2-yl]ethenyl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-2-[7-[(E)-2-(3-ethoxy-4-methylphenyl)ethenyl]-9,9-dimethylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 146292728 |
| Molecular Formula | C35H32O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 5-[(E)-2-[7-[(E)-2-(3-ethoxy-4-methylphenyl)ethenyl]-9,9-dimethylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
| SMILES | CCOc1cc(/C=C/c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc5c(c4)OCO5)ccc2-3)ccc1C |
| InChI | InChI=1S/C35H32O3/c1-5-36-33-20-26(7-6-23(33)2)10-8-24-12-15-28-29-16-13-25(19-31(29)35(3,4)30(28)18-24)9-11-27-14-17-32-34(21-27)38-22-37-32/h6-21H,5,22H2,1-4H3/b10-8+,11-9+ |
| InChIKey | VEZHJSUDKZHXPY-GFULKKFKSA-N |
| XLogP | 8.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|