C12H11BrF3N — CID 146293024
(E)-1-(4-bromophenyl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine (PubChem CID 146293024) has the molecular formula C12H11BrF3N and a molecular weight of 306.13 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine.
| Compound Name | (E)-1-(4-bromophenyl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 146293024 |
| Molecular Formula | C12H11BrF3N |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (E)-1-(4-bromophenyl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine |
| SMILES | C/N=C(\C=C(/C)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H11BrF3N/c1-8(12(14,15)16)7-11(17-2)9-3-5-10(13)6-4-9/h3-7H,1-2H3/b8-7+,17-11+ |
| InChIKey | ZNGJAQGAEHTZTL-NXFWIZADSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|