C9H16N2 — CID 146293665
3-methyl-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindazole (PubChem CID 146293665) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-methyl-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindazole.
| Compound Name | 3-methyl-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindazole |
|---|---|
| PubChem CID | 146293665 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-methyl-4-methylidene-1,2,3,3a,5,6,7,7a-octahydroindazole |
| SMILES | C=C1CCCC2NNC(C)C12 |
| InChI | InChI=1S/C9H16N2/c1-6-4-3-5-8-9(6)7(2)10-11-8/h7-11H,1,3-5H2,2H3 |
| InChIKey | JZSDWQVMSUDURD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|