C9H15IN2 — CID 146293787
1-iodo-3-methyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole (PubChem CID 146293787) has the molecular formula C9H15IN2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 1-iodo-3-methyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole.
| Compound Name | 1-iodo-3-methyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole |
|---|---|
| PubChem CID | 146293787 |
| Molecular Formula | C9H15IN2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-iodo-3-methyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole |
| SMILES | C=C1CCCC2C1C(C)NN2I |
| InChI | InChI=1S/C9H15IN2/c1-6-4-3-5-8-9(6)7(2)11-12(8)10/h7-9,11H,1,3-5H2,2H3 |
| InChIKey | RPIQTQHEQSWXLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|