C10H18N2 — CID 146293917
1,3-dimethyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole (PubChem CID 146293917) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,3-dimethyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole.
| Compound Name | 1,3-dimethyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole |
|---|---|
| PubChem CID | 146293917 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1,3-dimethyl-4-methylidene-3,3a,5,6,7,7a-hexahydro-2H-indazole |
| SMILES | C=C1CCCC2C1C(C)NN2C |
| InChI | InChI=1S/C10H18N2/c1-7-5-4-6-9-10(7)8(2)11-12(9)3/h8-11H,1,4-6H2,2-3H3 |
| InChIKey | MKRHJTFZISFIRJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|