C25H28ClF3N4O4S — CID 146294193
(4R)-2-[3-[(4-chlorophenyl)methyl-(furan-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide (PubChem CID 146294193) has the molecular formula C25H28ClF3N4O4S and a molecular weight of 573.04 g/mol. Its IUPAC name is (4R)-2-[3-[(4-chlorophenyl)methyl-(furan-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide.
| Compound Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(furan-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 146294193 |
| Molecular Formula | C25H28ClF3N4O4S |
| Molecular Weight | 573.04 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(furan-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
| SMILES | CC1(C)NC(C23CC(N(Cc4ccc(Cl)cc4)S(=O)(=O)c4ccco4)(C2)C3)=N[C@H]1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C25H28ClF3N4O4S/c1-22(2)19(20(34)30-10-9-25(27,28)29)31-21(32-22)23-13-24(14-23,15-23)33(12-16-5-7-17(26)8-6-16)38(35,36)18-4-3-11-37-18/h3-8,11,19H,9-10,12-15H2,1-2H3,(H,30,34)(H,31,32)/t19-,23?,24?/m0/s1 |
| InChIKey | HQOWBUMUYPTHCM-HLJPNSHOSA-N |
| XLogP | 4.26 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |