C30H19N2O4P — CID 146294472
13-hydroxy-10,16-dipyridin-3-yl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide (PubChem CID 146294472) has the molecular formula C30H19N2O4P and a molecular weight of 502.47 g/mol. Its IUPAC name is 13-hydroxy-10,16-dipyridin-3-yl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide.
| Compound Name | 13-hydroxy-10,16-dipyridin-3-yl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
|---|---|
| PubChem CID | 146294472 |
| Molecular Formula | C30H19N2O4P |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 13-hydroxy-10,16-dipyridin-3-yl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene 13-oxide |
| SMILES | O=P1(O)Oc2c(-c3cccnc3)cc3ccccc3c2-c2c(c(-c3cccnc3)cc3ccccc23)O1 |
| InChI | InChI=1S/C30H19N2O4P/c33-37(34)35-29-25(21-9-5-13-31-17-21)15-19-7-1-3-11-23(19)27(29)28-24-12-4-2-8-20(24)16-26(30(28)36-37)22-10-6-14-32-18-22/h1-18H,(H,33,34) |
| InChIKey | ADLFGFQNQAYRAE-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|