C20H23O4P — CID 146294486
13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3(8),9,17-pentaene 13-oxide (PubChem CID 146294486) has the molecular formula C20H23O4P and a molecular weight of 358.37 g/mol. Its IUPAC name is 13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3(8),9,17-pentaene 13-oxide.
| Compound Name | 13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3(8),9,17-pentaene 13-oxide |
|---|---|
| PubChem CID | 146294486 |
| Molecular Formula | C20H23O4P |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 13-hydroxy-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3(8),9,17-pentaene 13-oxide |
| SMILES | O=P1(O)Oc2ccc3c(c2C2=C4CCCCC4=CCC2O1)CCCC3 |
| InChI | InChI=1S/C20H23O4P/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25/h9-11,18H,1-8,12H2,(H,21,22) |
| InChIKey | QKAYJAYYRFXJJI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|