C5H6N2O3 — CID 14629456
1-methyl-1,3-diazinane-2,4,5-trione (PubChem CID 14629456) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 1-methyl-1,3-diazinane-2,4,5-trione.
| Compound Name | 1-methyl-1,3-diazinane-2,4,5-trione |
|---|---|
| PubChem CID | 14629456 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 1-methyl-1,3-diazinane-2,4,5-trione |
| SMILES | CN1CC(=O)C(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O3/c1-7-2-3(8)4(9)6-5(7)10/h2H2,1H3,(H,6,9,10) |
| InChIKey | FBBPOMRYJPJJEZ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|