C14H20BrN3OS2 — CID 146294637
[(2S,3S)-2-[(2-bromo-1,3-thiazol-4-yl)methyl]-3-(methylsulfanylamino)pyrrolidin-1-yl]-cyclobutylmethanone (PubChem CID 146294637) has the molecular formula C14H20BrN3OS2 and a molecular weight of 390.37 g/mol. Its IUPAC name is [(2S,3S)-2-[(2-bromo-1,3-thiazol-4-yl)methyl]-3-(methylsulfanylamino)pyrrolidin-1-yl]-cyclobutylmethanone.
| Compound Name | [(2S,3S)-2-[(2-bromo-1,3-thiazol-4-yl)methyl]-3-(methylsulfanylamino)pyrrolidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 146294637 |
| Molecular Formula | C14H20BrN3OS2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [(2S,3S)-2-[(2-bromo-1,3-thiazol-4-yl)methyl]-3-(methylsulfanylamino)pyrrolidin-1-yl]-cyclobutylmethanone |
| SMILES | CSN[C@H]1CCN(C(=O)C2CCC2)[C@H]1Cc1csc(Br)n1 |
| InChI | InChI=1S/C14H20BrN3OS2/c1-20-17-11-5-6-18(13(19)9-3-2-4-9)12(11)7-10-8-21-14(15)16-10/h8-9,11-12,17H,2-7H2,1H3/t11-,12-/m0/s1 |
| InChIKey | RJZHZUIVMBJKRX-RYUDHWBXSA-N |
| XLogP | 3.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|