C27H36N6O6 — CID 146294688
2-[4-[[(1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrimidine-5-carboxamide (PubChem CID 146294688) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-[4-[[(1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[(1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 146294688 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[4-[[(1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypyrimidine-5-carboxamide |
| SMILES | C[C@@H]1O[C@@H](ONC(=O)c2cnc(N3CCC(CNCc4cn(C)c5ccccc45)CC3)nc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H36N6O6/c1-16-22(34)23(35)24(36)26(38-16)39-31-25(37)18-13-29-27(30-14-18)33-9-7-17(8-10-33)11-28-12-19-15-32(2)21-6-4-3-5-20(19)21/h3-6,13-17,22-24,26,28,34-36H,7-12H2,1-2H3,(H,31,37)/t16-,22+,23+,24-,26-/m0/s1 |
| InChIKey | BUFYTCNJMWPIFE-LOKVVCKTSA-N |
| XLogP | 0.46 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|