About (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine
(E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine (PubChem CID 146294853) has the molecular formula C18H25N
and a molecular weight of 255.41 g/mol. Its IUPAC name is (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine.
Molecular Properties
| Compound Name | (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine |
| PubChem CID | 146294853 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine |
| SMILES | [H]/N=C(C)/C(C)=C/C1=C(CC)C(C)(C)C2C=CC=CC12 |
| InChI | InChI=1S/C18H25N/c1-6-16-15(11-12(2)13(3)19)14-9-7-8-10-17(14)18(16,4)5/h7-11,14,17,19H,6H2,1-5H3/b12-11+,19-13+ |
| InChIKey | HYCFHZCHMRTYPR-DUPDGBOPSA-N |
| XLogP | 5.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine?
The IUPAC name of (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine (CID 146294853) is (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine.
What is the SMILES notation for (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine?
The canonical SMILES for (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine is [H]/N=C(C)/C(C)=C/C1=C(CC)C(C)(C)C2C=CC=CC12.
What is the InChIKey of (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine?
The InChIKey is HYCFHZCHMRTYPR-DUPDGBOPSA-N. The full InChI is InChI=1S/C18H25N/c1-6-16-15(11-12(2)13(3)19)14-9-7-8-10-17(14)18(16,4)5/h7-11,14,17,19H,6H2,1-5H3/b12-11+,19-13+.
What are the key properties of (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine?
(E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine has a molecular weight of 255.41 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2-ethyl-3,3-dimethyl-3a,7a-dihydroinden-1-yl)-3-methylbut-3-en-2-imine is sourced from PubChem (CID 146294853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).