C17H36O4 — CID 146295425
2-tert-butylperoxy-2-methylpropane;2,2,3-trimethylhexanoic acid (PubChem CID 146295425) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;2,2,3-trimethylhexanoic acid.
| Compound Name | 2-tert-butylperoxy-2-methylpropane;2,2,3-trimethylhexanoic acid |
|---|---|
| PubChem CID | 146295425 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;2,2,3-trimethylhexanoic acid |
| SMILES | CC(C)(C)OOC(C)(C)C.CCCC(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C9H18O2.C8H18O2/c1-5-6-7(2)9(3,4)8(10)11;1-7(2,3)9-10-8(4,5)6/h7H,5-6H2,1-4H3,(H,10,11);1-6H3 |
| InChIKey | GEVKHUZEVBOHSR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|