C28H33N3O2 — CID 146295901
N-(2-cyclopentylethyl)-3-[2-methyl-4-(2-pyridin-2-ylethoxy)anilino]benzamide (PubChem CID 146295901) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-3-[2-methyl-4-(2-pyridin-2-ylethoxy)anilino]benzamide.
| Compound Name | N-(2-cyclopentylethyl)-3-[2-methyl-4-(2-pyridin-2-ylethoxy)anilino]benzamide |
|---|---|
| PubChem CID | 146295901 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-(2-cyclopentylethyl)-3-[2-methyl-4-(2-pyridin-2-ylethoxy)anilino]benzamide |
| SMILES | Cc1cc(OCCc2ccccn2)ccc1Nc1cccc(C(=O)NCCC2CCCC2)c1 |
| InChI | InChI=1S/C28H33N3O2/c1-21-19-26(33-18-15-24-10-4-5-16-29-24)12-13-27(21)31-25-11-6-9-23(20-25)28(32)30-17-14-22-7-2-3-8-22/h4-6,9-13,16,19-20,22,31H,2-3,7-8,14-15,17-18H2,1H3,(H,30,32) |
| InChIKey | HNVBXXDMLSVIAT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |