About 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione
7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 146295992) has the molecular formula C15H12BrN3O3
and a molecular weight of 362.18 g/mol. Its IUPAC name is 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| PubChem CID | 146295992 |
| Molecular Formula | C15H12BrN3O3 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(Br)c2cnc3c(=O)[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C15H12BrN3O3/c1-22-10-4-2-8(3-5-10)12(16)9-6-11-13(17-7-9)14(20)19-15(21)18-11/h2-7,12H,1H3,(H2,18,19,20,21) |
| InChIKey | YPOZHEWCMCGBPN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione?
The IUPAC name of 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione (CID 146295992) is 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione.
What is the SMILES notation for 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione?
The canonical SMILES for 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione is COc1ccc(C(Br)c2cnc3c(=O)[nH]c(=O)[nH]c3c2)cc1.
What is the InChIKey of 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione?
The InChIKey is YPOZHEWCMCGBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrN3O3/c1-22-10-4-2-8(3-5-10)12(16)9-6-11-13(17-7-9)14(20)19-15(21)18-11/h2-7,12H,1H3,(H2,18,19,20,21).
What are the key properties of 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione?
7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione has a molecular weight of 362.18 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[bromo-(4-methoxyphenyl)methyl]-1H-pyrido[3,2-d]pyrimidine-2,4-dione is sourced from PubChem (CID 146295992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).