C20H21F3O6 — CID 146296578
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[hydroxy-[2-methyl-4-(3,4,5-trifluorophenyl)phenyl]methyl]oxane-3,4,5-triol (PubChem CID 146296578) has the molecular formula C20H21F3O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[hydroxy-[2-methyl-4-(3,4,5-trifluorophenyl)phenyl]methyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[hydroxy-[2-methyl-4-(3,4,5-trifluorophenyl)phenyl]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146296578 |
| Molecular Formula | C20H21F3O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-[hydroxy-[2-methyl-4-(3,4,5-trifluorophenyl)phenyl]methyl]oxane-3,4,5-triol |
| SMILES | Cc1cc(-c2cc(F)c(F)c(F)c2)ccc1C(O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H21F3O6/c1-8-4-9(10-5-12(21)15(23)13(22)6-10)2-3-11(8)16(25)20-19(28)18(27)17(26)14(7-24)29-20/h2-6,14,16-20,24-28H,7H2,1H3/t14-,16?,17-,18+,19+,20-/m1/s1 |
| InChIKey | BADJNWXRFSOAJF-IWTJSAASSA-N |
| XLogP | 0.96 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|