C21H24F2O6 — CID 146296579
(2R,3S,4S,5S,6R)-2-[(R)-[4-(3,5-difluoro-4-methylphenyl)-2-methylphenyl]-hydroxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 146296579) has the molecular formula C21H24F2O6 and a molecular weight of 410.41 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[(R)-[4-(3,5-difluoro-4-methylphenyl)-2-methylphenyl]-hydroxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[(R)-[4-(3,5-difluoro-4-methylphenyl)-2-methylphenyl]-hydroxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146296579 |
| Molecular Formula | C21H24F2O6 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[(R)-[4-(3,5-difluoro-4-methylphenyl)-2-methylphenyl]-hydroxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(-c2cc(F)c(C)c(F)c2)ccc1[C@@H](O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24F2O6/c1-9-5-11(12-6-14(22)10(2)15(23)7-12)3-4-13(9)17(25)21-20(28)19(27)18(26)16(8-24)29-21/h3-7,16-21,24-28H,8H2,1-2H3/t16-,17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | OHRKGBOWYXFISR-COXXTLHVSA-N |
| XLogP | 1.12 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |