C19H21N3O7 — CID 146296881
[(3S,4S)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]oxan-3-yl]carbamic acid (PubChem CID 146296881) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is [(3S,4S)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]oxan-3-yl]carbamic acid.
| Compound Name | [(3S,4S)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 146296881 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(3S,4S)-4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1COCC[C@@H]1Oc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H21N3O7/c23-16-4-3-14(17(24)21-16)22-8-10-7-11(1-2-12(10)18(22)25)29-15-5-6-28-9-13(15)20-19(26)27/h1-2,7,13-15,20H,3-6,8-9H2,(H,26,27)(H,21,23,24)/t13-,14?,15-/m0/s1 |
| InChIKey | CUBWLQUBMRBGGA-LWEDLAQUSA-N |
| XLogP | 0.25 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|