C23H27FN2O3S — CID 146297644
N-[(2S,3S)-2-[[3-(3-fluorophenyl)phenyl]methyl]-1-pent-4-enoylpyrrolidin-3-yl]methanesulfonamide (PubChem CID 146297644) has the molecular formula C23H27FN2O3S and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[(2S,3S)-2-[[3-(3-fluorophenyl)phenyl]methyl]-1-pent-4-enoylpyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2S,3S)-2-[[3-(3-fluorophenyl)phenyl]methyl]-1-pent-4-enoylpyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146297644 |
| Molecular Formula | C23H27FN2O3S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(2S,3S)-2-[[3-(3-fluorophenyl)phenyl]methyl]-1-pent-4-enoylpyrrolidin-3-yl]methanesulfonamide |
| SMILES | C=CCCC(=O)N1CC[C@H](NS(C)(=O)=O)[C@@H]1Cc1cccc(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H27FN2O3S/c1-3-4-11-23(27)26-13-12-21(25-30(2,28)29)22(26)15-17-7-5-8-18(14-17)19-9-6-10-20(24)16-19/h3,5-10,14,16,21-22,25H,1,4,11-13,15H2,2H3/t21-,22-/m0/s1 |
| InChIKey | SUYUMMYEWSVXDF-VXKWHMMOSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|