C25H27ClN2O9 — CID 146297700
5-[5-chloro-2-hydroxy-4-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 146297700) has the molecular formula C25H27ClN2O9 and a molecular weight of 534.95 g/mol. Its IUPAC name is 5-[5-chloro-2-hydroxy-4-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[5-chloro-2-hydroxy-4-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 146297700 |
| Molecular Formula | C25H27ClN2O9 |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 5-[5-chloro-2-hydroxy-4-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-N-ethyl-4-(4-methoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(Cl)c(O[C@@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]3O)cc2O)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H27ClN2O9/c1-4-27-24(33)19-18(12-5-7-13(34-3)8-6-12)23(37-28-19)14-9-15(26)17(10-16(14)29)36-25-22(32)21(31)20(30)11(2)35-25/h5-11,20-22,25,29-32H,4H2,1-3H3,(H,27,33)/t11-,20+,21+,22-,25-/m0/s1 |
| InChIKey | OCVWPWRHOUFZCU-TYRQSQAWSA-N |
| XLogP | 2.33 |
| TPSA | 163.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |