About 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one
4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one (PubChem CID 146298557) has the molecular formula C19H18F3NO2
and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one |
| PubChem CID | 146298557 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one |
| SMILES | Cc1ccc(N2CC(c3ccc(C(F)(F)F)cc3)OCCC2=O)cc1 |
| InChI | InChI=1S/C19H18F3NO2/c1-13-2-8-16(9-3-13)23-12-17(25-11-10-18(23)24)14-4-6-15(7-5-14)19(20,21)22/h2-9,17H,10-12H2,1H3 |
| InChIKey | REEDYDHHGZWXNW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one?
The IUPAC name of 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one (CID 146298557) is 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one.
What is the SMILES notation for 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one?
The canonical SMILES for 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one is Cc1ccc(N2CC(c3ccc(C(F)(F)F)cc3)OCCC2=O)cc1.
What is the InChIKey of 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one?
The InChIKey is REEDYDHHGZWXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3NO2/c1-13-2-8-16(9-3-13)23-12-17(25-11-10-18(23)24)14-4-6-15(7-5-14)19(20,21)22/h2-9,17H,10-12H2,1H3.
What are the key properties of 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one?
4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one has a molecular weight of 349.35 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]-1,4-oxazepan-5-one is sourced from PubChem (CID 146298557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).