C30H33F5N4O5S — CID 146298706
2-[(2S)-2-[2-(difluoromethoxy)ethyl]-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]pyrimidine-5-carboxamide (PubChem CID 146298706) has the molecular formula C30H33F5N4O5S and a molecular weight of 656.67 g/mol. Its IUPAC name is 2-[(2S)-2-[2-(difluoromethoxy)ethyl]-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-[(2S)-2-[2-(difluoromethoxy)ethyl]-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 146298706 |
| Molecular Formula | C30H33F5N4O5S |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 2-[(2S)-2-[2-(difluoromethoxy)ethyl]-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]-N-[(1R)-1-(4-ethylsulfonylphenyl)-2-hydroxyethyl]pyrimidine-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CO)NC(=O)c2cnc(N3CC(c4ccc(C(F)(F)F)cc4)CC[C@H]3CCOC(F)F)nc2)cc1 |
| InChI | InChI=1S/C30H33F5N4O5S/c1-2-45(42,43)25-11-6-20(7-12-25)26(18-40)38-27(41)22-15-36-29(37-16-22)39-17-21(5-10-24(39)13-14-44-28(31)32)19-3-8-23(9-4-19)30(33,34)35/h3-4,6-9,11-12,15-16,21,24,26,28,40H,2,5,10,13-14,17-18H2,1H3,(H,38,41)/t21?,24-,26-/m0/s1 |
| InChIKey | SSHORSULPAGMPK-KLZDYHPHSA-N |
| XLogP | 5.13 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |