C14H23NO — CID 146300108
(1R,8S,15S)-12-azatricyclo[6.6.1.04,15]pentadecan-11-one (PubChem CID 146300108) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (1R,8S,15S)-12-azatricyclo[6.6.1.04,15]pentadecan-11-one.
| Compound Name | (1R,8S,15S)-12-azatricyclo[6.6.1.04,15]pentadecan-11-one |
|---|---|
| PubChem CID | 146300108 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (1R,8S,15S)-12-azatricyclo[6.6.1.04,15]pentadecan-11-one |
| SMILES | O=C1CC[C@@H]2CCCC3CC[C@H](CCN1)[C@@H]32 |
| InChI | InChI=1S/C14H23NO/c16-13-7-6-11-3-1-2-10-4-5-12(14(10)11)8-9-15-13/h10-12,14H,1-9H2,(H,15,16)/t10?,11-,12+,14-/m0/s1 |
| InChIKey | CVOMTUICKITRSH-CMGMYYOESA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |